C21H31N2O8P — CID 178103698
2-[(2R,3S,6R)-6-[4-(hex-5-ynylcarbamoylamino)-3-methylphenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonous acid (PubChem CID 178103698) has the molecular formula C21H31N2O8P and a molecular weight of 470.46 g/mol. Its IUPAC name is 2-[(2R,3S,6R)-6-[4-(hex-5-ynylcarbamoylamino)-3-methylphenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonous acid.
| Compound Name | 2-[(2R,3S,6R)-6-[4-(hex-5-ynylcarbamoylamino)-3-methylphenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonous acid |
|---|---|
| PubChem CID | 178103698 |
| Molecular Formula | C21H31N2O8P |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[(2R,3S,6R)-6-[4-(hex-5-ynylcarbamoylamino)-3-methylphenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonous acid |
| SMILES | C#CCCCCNC(=O)Nc1ccc(O[C@H]2O[C@H](CCP(O)O)[C@@H](O)C(O)C2O)cc1C |
| InChI | InChI=1S/C21H31N2O8P/c1-3-4-5-6-10-22-21(27)23-15-8-7-14(12-13(15)2)30-20-19(26)18(25)17(24)16(31-20)9-11-32(28)29/h1,7-8,12,16-20,24-26,28-29H,4-6,9-11H2,2H3,(H2,22,23,27)/t16-,17-,18?,19?,20+/m1/s1 |
| InChIKey | ORFNBJUUNXJIGK-WTCKFOIOSA-N |
| XLogP | 0.79 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|