C25H31O8P — CID 166172053
2-[(2R,3S,4S,5S,6R)-6-[4-(3-hex-5-ynylphenyl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid (PubChem CID 166172053) has the molecular formula C25H31O8P and a molecular weight of 490.49 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6R)-6-[4-(3-hex-5-ynylphenyl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S,6R)-6-[4-(3-hex-5-ynylphenyl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 166172053 |
| Molecular Formula | C25H31O8P |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6R)-6-[4-(3-hex-5-ynylphenyl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethylphosphonic acid |
| SMILES | C#CCCCCc1cccc(-c2ccc(O[C@H]3O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C25H31O8P/c1-2-3-4-5-7-17-8-6-9-19(16-17)18-10-12-20(13-11-18)32-25-24(28)23(27)22(26)21(33-25)14-15-34(29,30)31/h1,6,8-13,16,21-28H,3-5,7,14-15H2,(H2,29,30,31)/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | GROXQBGYKWINKZ-VAFBSOEGSA-N |
| XLogP | 2.45 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|