C20H28N2O8S2 — CID 166068936
2-[(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamothioylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonic acid (PubChem CID 166068936) has the molecular formula C20H28N2O8S2 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamothioylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonic acid.
| Compound Name | 2-[(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamothioylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 166068936 |
| Molecular Formula | C20H28N2O8S2 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamothioylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonic acid |
| SMILES | C#CCCCCNC(=S)Nc1ccc(O[C@H]2O[C@H](CCS(=O)(=O)O)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H28N2O8S2/c1-2-3-4-5-11-21-20(31)22-13-6-8-14(9-7-13)29-19-18(25)17(24)16(23)15(30-19)10-12-32(26,27)28/h1,6-9,15-19,23-25H,3-5,10-12H2,(H2,21,22,31)(H,26,27,28)/t15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | AWDDKDGTCOFMRO-GFEQUFNTSA-N |
| XLogP | 0.24 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|