C19H30N2O5S — CID 163441705
1-[2-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl]-3-[4-(3-methylbutoxy)phenyl]thiourea (PubChem CID 163441705) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[2-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl]-3-[4-(3-methylbutoxy)phenyl]thiourea.
| Compound Name | 1-[2-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl]-3-[4-(3-methylbutoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 163441705 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[2-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]ethyl]-3-[4-(3-methylbutoxy)phenyl]thiourea |
| SMILES | CC(C)CCOc1ccc(NC(=S)NCC[C@@H]2O[C@H](CO)C(O)C2O)cc1 |
| InChI | InChI=1S/C19H30N2O5S/c1-12(2)8-10-25-14-5-3-13(4-6-14)21-19(27)20-9-7-15-17(23)18(24)16(11-22)26-15/h3-6,12,15-18,22-24H,7-11H2,1-2H3,(H2,20,21,27)/t15-,16+,17?,18?/m0/s1 |
| InChIKey | AZCYTLHYZTYDLV-KNXWPPODSA-N |
| XLogP | 1.27 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|