C17H26N2O5S — CID 58166324
1-[(3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[4-(3-methylbutoxy)phenyl]thiourea (PubChem CID 58166324) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-[(3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[4-(3-methylbutoxy)phenyl]thiourea.
| Compound Name | 1-[(3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[4-(3-methylbutoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 58166324 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[(3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[4-(3-methylbutoxy)phenyl]thiourea |
| SMILES | CC(C)CCOc1ccc(NC(=S)NC2O[C@H](CO)C(O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H26N2O5S/c1-10(2)7-8-23-12-5-3-11(4-6-12)18-17(25)19-16-15(22)14(21)13(9-20)24-16/h3-6,10,13-16,20-22H,7-9H2,1-2H3,(H2,18,19,25)/t13-,14?,15+,16?/m1/s1 |
| InChIKey | UJDLUMCNDPKJME-CIDNJEQPSA-N |
| XLogP | 0.84 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|