C16H22N2O8 — CID 129449560
ethyl 4-[[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamoylamino]benzoate (PubChem CID 129449560) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is ethyl 4-[[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 129449560 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 4-[[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N[C@@H]2O[C@H](CO)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H22N2O8/c1-2-25-15(23)8-3-5-9(6-4-8)17-16(24)18-14-13(22)12(21)11(20)10(7-19)26-14/h3-6,10-14,19-22H,2,7H2,1H3,(H2,17,18,24)/t10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | MVUGFPZSODNQEX-XVIXHAIJSA-N |
| XLogP | -1.22 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |