C13H19N3O7S2 — CID 57394771
1-(4-sulfamoylphenyl)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea (PubChem CID 57394771) has the molecular formula C13H19N3O7S2 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
|---|---|
| PubChem CID | 57394771 |
| Molecular Formula | C13H19N3O7S2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)N[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H19N3O7S2/c14-25(21,22)7-3-1-6(2-4-7)15-13(24)16-12-11(20)10(19)9(18)8(5-17)23-12/h1-4,8-12,17-20H,5H2,(H2,14,21,22)(H2,15,16,24)/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | PECXPDOXZCZHML-YBXAARCKSA-N |
| XLogP | -2.58 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|