C13H17N3O8 — CID 25023344
1-(4-nitrophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea (PubChem CID 25023344) has the molecular formula C13H17N3O8 and a molecular weight of 343.29 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea.
| Compound Name | 1-(4-nitrophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
|---|---|
| PubChem CID | 25023344 |
| Molecular Formula | C13H17N3O8 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17N3O8/c17-5-8-9(18)10(19)11(20)12(24-8)15-13(21)14-6-1-3-7(4-2-6)16(22)23/h1-4,8-12,17-20H,5H2,(H2,14,15,21)/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | HSDGWRANLPERRB-RMPHRYRLSA-N |
| XLogP | -1.48 |
| TPSA | 174.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|