C13H16N4O7S — CID 177475790
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-nitrophenyl)carbamothioylamino]oxane-2-carboxamide (PubChem CID 177475790) has the molecular formula C13H16N4O7S and a molecular weight of 372.36 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-nitrophenyl)carbamothioylamino]oxane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-nitrophenyl)carbamothioylamino]oxane-2-carboxamide |
|---|---|
| PubChem CID | 177475790 |
| Molecular Formula | C13H16N4O7S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-nitrophenyl)carbamothioylamino]oxane-2-carboxamide |
| SMILES | NC(=O)[C@H]1O[C@@H](NC(=S)Nc2ccc([N+](=O)[O-])cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16N4O7S/c14-11(21)10-8(19)7(18)9(20)12(24-10)16-13(25)15-5-1-3-6(4-2-5)17(22)23/h1-4,7-10,12,18-20H,(H2,14,21)(H2,15,16,25)/t7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | ZLEFZYAPANBUPK-GOVZDWNOSA-N |
| XLogP | -1.83 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|