C21H25N3O11S — CID 10720912
[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(4-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 10720912) has the molecular formula C21H25N3O11S and a molecular weight of 527.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(4-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(4-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10720912 |
| Molecular Formula | C21H25N3O11S |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(4-nitrophenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=S)Nc2ccc([N+](=O)[O-])cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25N3O11S/c1-10(25)31-9-16-18(32-11(2)26)19(33-12(3)27)17(20(35-16)34-13(4)28)23-21(36)22-14-5-7-15(8-6-14)24(29)30/h5-8,16-20H,9H2,1-4H3,(H2,22,23,36)/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | LZCSHJAIWZRLLI-LASHMREHSA-N |
| XLogP | 0.96 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|