C18H21ClN2O7S — CID 101089617
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[(4-chlorophenyl)carbamothioylamino]oxolan-2-yl]methyl acetate (PubChem CID 101089617) has the molecular formula C18H21ClN2O7S and a molecular weight of 444.89 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[(4-chlorophenyl)carbamothioylamino]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[(4-chlorophenyl)carbamothioylamino]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101089617 |
| Molecular Formula | C18H21ClN2O7S |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[(4-chlorophenyl)carbamothioylamino]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=S)Nc2ccc(Cl)cc2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H21ClN2O7S/c1-9(22)25-8-14-15(26-10(2)23)16(27-11(3)24)17(28-14)21-18(29)20-13-6-4-12(19)5-7-13/h4-7,14-17H,8H2,1-3H3,(H2,20,21,29)/t14-,15-,16-,17-/m1/s1 |
| InChIKey | IAYLWTCKDRGIKF-QBPKDAKJSA-N |
| XLogP | 1.78 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|