C29H40N2O18S — CID 2825771
[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 2825771) has the molecular formula C29H40N2O18S and a molecular weight of 736.70 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 2825771 |
| Molecular Formula | C29H40N2O18S |
| Molecular Weight | 736.70 g/mol |
| Exact Mass | 736.20 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](NC(=S)N[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H40N2O18S/c1-11(32)40-9-19-21(42-13(3)34)23(44-15(5)36)25(46-17(7)38)27(48-19)30-29(50)31-28-26(47-18(8)39)24(45-16(6)37)22(43-14(4)35)20(49-28)10-41-12(2)33/h19-28H,9-10H2,1-8H3,(H2,30,31,50)/t19-,20+,21-,22+,23+,24-,25-,26+,27-,28+ |
| InChIKey | HQXVZJGPEKDKJC-CDWAOWJDSA-N |
| XLogP | -1.38 |
| TPSA | 252.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.70 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|