C20H32N4O9S — CID 9499893
[(2R,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-methylpiperazin-1-yl)carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 9499893) has the molecular formula C20H32N4O9S and a molecular weight of 504.56 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-methylpiperazin-1-yl)carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-methylpiperazin-1-yl)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 9499893 |
| Molecular Formula | C20H32N4O9S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-[(4-methylpiperazin-1-yl)carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=S)NN2CCN(C)CC2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H32N4O9S/c1-11(25)29-10-15-16(30-12(2)26)17(31-13(3)27)18(32-14(4)28)19(33-15)21-20(34)22-24-8-6-23(5)7-9-24/h15-19H,6-10H2,1-5H3,(H2,21,22,34)/t15-,16+,17+,18+,19-/m1/s1 |
| InChIKey | WKYBQUMXVCVXDC-HVMFNXBNSA-N |
| XLogP | -1.30 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|