C18H27N3O9S — CID 71745679
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]oxan-2-yl]methyl acetate (PubChem CID 71745679) has the molecular formula C18H27N3O9S and a molecular weight of 461.49 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71745679 |
| Molecular Formula | C18H27N3O9S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](NC(=S)/N=C/N(C)C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H27N3O9S/c1-9(22)26-7-13-14(27-10(2)23)15(28-11(3)24)16(29-12(4)25)17(30-13)20-18(31)19-8-21(5)6/h8,13-17H,7H2,1-6H3,(H,20,31)/b19-8+/t13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | KMTPWOOZXPFPIC-DRXNVSNDSA-N |
| XLogP | -0.47 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|