C18H27NO10S — CID 3907785
[3,4,5-triacetyloxy-6-(propoxycarbothioylamino)oxan-2-yl]methyl acetate (PubChem CID 3907785) has the molecular formula C18H27NO10S and a molecular weight of 449.48 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(propoxycarbothioylamino)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(propoxycarbothioylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3907785 |
| Molecular Formula | C18H27NO10S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(propoxycarbothioylamino)oxan-2-yl]methyl acetate |
| SMILES | CCCOC(=S)NC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H27NO10S/c1-6-7-24-18(30)19-17-16(28-12(5)23)15(27-11(4)22)14(26-10(3)21)13(29-17)8-25-9(2)20/h13-17H,6-8H2,1-5H3,(H,19,30) |
| InChIKey | HYYUGIUQUYOATK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|