C19H26N2O13S — CID 18637494
2-[carboxymethyl-[[(3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioyl]amino]acetic acid (PubChem CID 18637494) has the molecular formula C19H26N2O13S and a molecular weight of 522.49 g/mol. Its IUPAC name is 2-[carboxymethyl-[[(3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[[(3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioyl]amino]acetic acid |
|---|---|
| PubChem CID | 18637494 |
| Molecular Formula | C19H26N2O13S |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 2-[carboxymethyl-[[(3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]carbamothioyl]amino]acetic acid |
| SMILES | CC(=O)OC[C@H]1OC(NC(=S)N(CC(=O)O)CC(=O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H26N2O13S/c1-8(22)30-7-12-15(31-9(2)23)16(32-10(3)24)17(33-11(4)25)18(34-12)20-19(35)21(5-13(26)27)6-14(28)29/h12,15-18H,5-7H2,1-4H3,(H,20,35)(H,26,27)(H,28,29)/t12-,15+,16+,17-,18?/m1/s1 |
| InChIKey | FXQIGKLPCCNTFU-ALULZMFBSA-N |
| XLogP | -1.58 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|