C19H28N2O10S — CID 124924108
[(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(morpholine-4-carbothioylamino)oxan-2-yl]methyl acetate (PubChem CID 124924108) has the molecular formula C19H28N2O10S and a molecular weight of 476.50 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(morpholine-4-carbothioylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(morpholine-4-carbothioylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124924108 |
| Molecular Formula | C19H28N2O10S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(morpholine-4-carbothioylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](NC(=S)N2CCOCC2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H28N2O10S/c1-10(22)27-9-14-15(28-11(2)23)16(29-12(3)24)17(30-13(4)25)18(31-14)20-19(32)21-5-7-26-8-6-21/h14-18H,5-9H2,1-4H3,(H,20,32)/t14-,15+,16-,17+,18-/m0/s1 |
| InChIKey | YHICQBYMVKLAMY-RZFLPCETSA-N |
| XLogP | -0.72 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|