C21H24ClNO10S — CID 124919690
[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbothioylamino]oxan-2-yl]methyl acetate (PubChem CID 124919690) has the molecular formula C21H24ClNO10S and a molecular weight of 517.94 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124919690 |
| Molecular Formula | C21H24ClNO10S |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](NC(=S)Oc2ccc(Cl)cc2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24ClNO10S/c1-10(24)28-9-16-17(29-11(2)25)18(30-12(3)26)19(31-13(4)27)20(33-16)23-21(34)32-15-7-5-14(22)6-8-15/h5-8,16-20H,9H2,1-4H3,(H,23,34)/t16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | BJNLCTXPPRPFFK-OMZCGLGVSA-N |
| XLogP | 1.68 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|