C27H30N2O10S — CID 124922572
[(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-phenoxyphenyl)carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 124922572) has the molecular formula C27H30N2O10S and a molecular weight of 574.61 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-phenoxyphenyl)carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-phenoxyphenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124922572 |
| Molecular Formula | C27H30N2O10S |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(4-phenoxyphenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](NC(=S)Nc2ccc(Oc3ccccc3)cc2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H30N2O10S/c1-15(30)34-14-22-23(35-16(2)31)24(36-17(3)32)25(37-18(4)33)26(39-22)29-27(40)28-19-10-12-21(13-11-19)38-20-8-6-5-7-9-20/h5-13,22-26H,14H2,1-4H3,(H2,28,29,40)/t22-,23+,24+,25+,26-/m0/s1 |
| InChIKey | RPGZUPIDELFEPL-QJEZIUSSSA-N |
| XLogP | 2.85 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|