C22H28N2O9S — CID 51670173
[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(3-methylphenyl)carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 51670173) has the molecular formula C22H28N2O9S and a molecular weight of 496.54 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(3-methylphenyl)carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(3-methylphenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 51670173 |
| Molecular Formula | C22H28N2O9S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[(3-methylphenyl)carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](NC(=S)Nc2cccc(C)c2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28N2O9S/c1-11-7-6-8-16(9-11)23-22(34)24-21-20(32-15(5)28)19(31-14(4)27)18(30-13(3)26)17(33-21)10-29-12(2)25/h6-9,17-21H,10H2,1-5H3,(H2,23,24,34)/t17-,18+,19+,20+,21+/m0/s1 |
| InChIKey | YGPIWLLWGXTPSY-SRHPJPHMSA-N |
| XLogP | 1.36 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|