C21H26FN3O9S — CID 44581228
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-fluoroanilino)carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 44581228) has the molecular formula C21H26FN3O9S and a molecular weight of 515.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-fluoroanilino)carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-fluoroanilino)carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44581228 |
| Molecular Formula | C21H26FN3O9S |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-fluoroanilino)carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=S)NNc2ccc(F)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H26FN3O9S/c1-10(26)30-9-16-17(31-11(2)27)18(32-12(3)28)19(33-13(4)29)20(34-16)23-21(35)25-24-15-7-5-14(22)6-8-15/h5-8,16-20,24H,9H2,1-4H3,(H2,23,25,35)/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | LENJQFCOJXKJCX-OUUBHVDSSA-N |
| XLogP | 0.70 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|