C21H24ClNO11 — CID 102140740
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbonylamino]oxan-2-yl]methyl acetate (PubChem CID 102140740) has the molecular formula C21H24ClNO11 and a molecular weight of 501.87 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbonylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbonylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102140740 |
| Molecular Formula | C21H24ClNO11 |
| Molecular Weight | 501.87 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(4-chlorophenoxy)carbonylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)Oc2ccc(Cl)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24ClNO11/c1-10(24)29-9-16-17(30-11(2)25)18(31-12(3)26)19(32-13(4)27)20(34-16)23-21(28)33-15-7-5-14(22)6-8-15/h5-8,16-20H,9H2,1-4H3,(H,23,28)/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | OCGOUQGKKGYBGV-LCWAXJCOSA-N |
| XLogP | 1.51 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.87 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|