C23H37N3O9S — CID 164887258
[3,4,5-triacetyloxy-6-[[(1S,2S)-2-(dimethylamino)cyclohexyl]carbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 164887258) has the molecular formula C23H37N3O9S and a molecular weight of 531.63 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[(1S,2S)-2-(dimethylamino)cyclohexyl]carbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[(1S,2S)-2-(dimethylamino)cyclohexyl]carbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164887258 |
| Molecular Formula | C23H37N3O9S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[(1S,2S)-2-(dimethylamino)cyclohexyl]carbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(NC(=S)N[C@H]2CCCC[C@@H]2N(C)C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H37N3O9S/c1-12(27)31-11-18-19(32-13(2)28)20(33-14(3)29)21(34-15(4)30)22(35-18)25-23(36)24-16-9-7-8-10-17(16)26(5)6/h16-22H,7-11H2,1-6H3,(H2,24,25,36)/t16-,17-,18?,19?,20?,21?,22?/m0/s1 |
| InChIKey | ZMEBAEJTAVXJBS-AHMBWHQHSA-N |
| XLogP | 0.41 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|