C33H41N2O9PS — CID 141256437
[(2R,3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-diphenylphosphanylcyclohexyl)carbamothioylamino]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141256437) has the molecular formula C33H41N2O9PS and a molecular weight of 676.76 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-diphenylphosphanylcyclohexyl)carbamothioylamino]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-diphenylphosphanylcyclohexyl)carbamothioylamino]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141256437 |
| Molecular Formula | C33H41N2O9PS |
| Molecular Weight | 676.76 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-[(2-diphenylphosphanylcyclohexyl)carbamothioylamino]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1O[C@@H](NC(=S)NC2CCCCC2P(c2ccccc2)c2ccccc2)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C33H41N2O9PS/c1-20(36)40-19-27-29(41-21(2)37)30(42-22(3)38)31(43-23(4)39)32(44-27)35-33(46)34-26-17-11-12-18-28(26)45(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-10,13-16,26-32H,11-12,17-19H2,1-4H3,(H2,34,35,46)/t26?,27-,28?,29-,30+,31-,32-/m1/s1/i1D,2D,3D,4D |
| InChIKey | WIEZEUKHERKPDA-JADLSEQSSA-N |
| XLogP | 2.98 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|