C16H17N5O8 — CID 22503863
1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopyrimidin-4-yl]-3-(4-nitrophenyl)urea (PubChem CID 22503863) has the molecular formula C16H17N5O8 and a molecular weight of 407.34 g/mol. Its IUPAC name is 1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopyrimidin-4-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopyrimidin-4-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 22503863 |
| Molecular Formula | C16H17N5O8 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopyrimidin-4-yl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1cc(=O)n(C2OC(CO)C(O)C2O)cn1 |
| InChI | InChI=1S/C16H17N5O8/c22-6-10-13(24)14(25)15(29-10)20-7-17-11(5-12(20)23)19-16(26)18-8-1-3-9(4-2-8)21(27)28/h1-5,7,10,13-15,22,24-25H,6H2,(H2,18,19,26) |
| InChIKey | HVMNNROVCONPJZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 189.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|