C7H15BrN2O5S — CID 176657613
[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea;hydrobromide (PubChem CID 176657613) has the molecular formula C7H15BrN2O5S and a molecular weight of 319.18 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea;hydrobromide.
| Compound Name | [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea;hydrobromide |
|---|---|
| PubChem CID | 176657613 |
| Molecular Formula | C7H15BrN2O5S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea;hydrobromide |
| SMILES | Br.NC(=S)NC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14N2O5S.BrH/c8-7(15)9-6-5(13)4(12)3(11)2(1-10)14-6;/h2-6,10-13H,1H2,(H3,8,9,15);1H/t2-,3+,4+,5-,6?;/m1./s1 |
| InChIKey | QMHUMHIOTQSFOS-HLTNBIPTSA-N |
| XLogP | -2.80 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|