C11H20N2O6S — CID 54170448
N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]morpholine-4-carbothioamide (PubChem CID 54170448) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]morpholine-4-carbothioamide.
| Compound Name | N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 54170448 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]morpholine-4-carbothioamide |
| SMILES | OC[C@H]1O[C@@H](NC(=S)N2CCOCC2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N2O6S/c14-5-6-7(15)8(16)9(17)10(19-6)12-11(20)13-1-3-18-4-2-13/h6-10,14-17H,1-5H2,(H,12,20)/t6-,7-,8+,9-,10-/m1/s1 |
| InChIKey | OUQQJPMDLDHSEA-HOTMZDKISA-N |
| XLogP | -3.01 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|