C13H23NO6S — CID 1244541
O-cyclohexyl N-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamothioate (PubChem CID 1244541) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is O-cyclohexyl N-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamothioate.
| Compound Name | O-cyclohexyl N-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamothioate |
|---|---|
| PubChem CID | 1244541 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | O-cyclohexyl N-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]carbamothioate |
| SMILES | OC[C@H]1O[C@H](NC(=S)OC2CCCCC2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO6S/c15-6-8-9(16)10(17)11(18)12(20-8)14-13(21)19-7-4-2-1-3-5-7/h7-12,15-18H,1-6H2,(H,14,21)/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | ZVODTJXEIOKKBX-GCHJQGSQSA-N |
| XLogP | -0.99 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|