C12H23N3O5S — CID 54410292
4-methyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]piperazine-1-carbothioamide (PubChem CID 54410292) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-methyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54410292 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-methyl-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)N[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C12H23N3O5S/c1-14-2-4-15(5-3-14)12(21)13-11-10(19)9(18)8(17)7(6-16)20-11/h7-11,16-19H,2-6H2,1H3,(H,13,21)/t7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | VTQDEEOZMFVLAL-KAMPLNKDSA-N |
| XLogP | -3.09 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|