C9H19N3O5S — CID 7073792
1,3-dimethyl-1-[[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea (PubChem CID 7073792) has the molecular formula C9H19N3O5S and a molecular weight of 281.33 g/mol. Its IUPAC name is 1,3-dimethyl-1-[[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea.
| Compound Name | 1,3-dimethyl-1-[[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea |
|---|---|
| PubChem CID | 7073792 |
| Molecular Formula | C9H19N3O5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1,3-dimethyl-1-[[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea |
| SMILES | CNC(=S)N(C)N[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H19N3O5S/c1-10-9(18)12(2)11-8-7(16)6(15)5(14)4(3-13)17-8/h4-8,11,13-16H,3H2,1-2H3,(H,10,18)/t4-,5+,6+,7+,8+/m0/s1 |
| InChIKey | CZAXWGAIRIMUOG-SLBCVNJHSA-N |
| XLogP | -3.27 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|