C8H15NO6S — CID 134517852
S-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-methylcarbamothioate (PubChem CID 134517852) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is S-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-methylcarbamothioate.
| Compound Name | S-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 134517852 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | S-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N-methylcarbamothioate |
| SMILES | CNC(=O)SC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15NO6S/c1-9-8(14)16-7-6(13)5(12)4(11)3(2-10)15-7/h3-7,10-13H,2H2,1H3,(H,9,14)/t3-,4-,5+,6-,7?/m1/s1 |
| InChIKey | FDJFYBJAACRQDA-WLDMJGECSA-N |
| XLogP | -2.14 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|