C8H17AsO5S — CID 3034600
(2S,3R,4S,5S,6R)-2-dimethylarsanylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 3034600) has the molecular formula C8H17AsO5S and a molecular weight of 300.21 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-dimethylarsanylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-dimethylarsanylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 3034600 |
| Molecular Formula | C8H17AsO5S |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-dimethylarsanylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C[As](C)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H17AsO5S/c1-9(2)15-8-7(13)6(12)5(11)4(3-10)14-8/h4-8,10-13H,3H2,1-2H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | HPAQFJUTESIJBQ-CBQIKETKSA-N |
| XLogP | -1.23 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|