C8H17N3O5S — CID 124909209
1-methyl-3-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea (PubChem CID 124909209) has the molecular formula C8H17N3O5S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-methyl-3-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea.
| Compound Name | 1-methyl-3-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea |
|---|---|
| PubChem CID | 124909209 |
| Molecular Formula | C8H17N3O5S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-methyl-3-[[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]thiourea |
| SMILES | CNC(=S)NN[C@@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17N3O5S/c1-9-8(17)11-10-7-6(15)5(14)4(13)3(2-12)16-7/h3-7,10,12-15H,2H2,1H3,(H2,9,11,17)/t3-,4+,5-,6+,7-/m1/s1 |
| InChIKey | ZYCQJYPTFJTULD-IBISWUOJSA-N |
| XLogP | -3.62 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|