C13H18ClN3O5SZn — CID 44817599
chlorozinc(1+);(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(phenylcarbamothioyl)hydrazinyl]oxan-3-olate (PubChem CID 44817599) has the molecular formula C13H18ClN3O5SZn and a molecular weight of 429.21 g/mol. Its IUPAC name is chlorozinc(1+);(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(phenylcarbamothioyl)hydrazinyl]oxan-3-olate.
| Compound Name | chlorozinc(1+);(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(phenylcarbamothioyl)hydrazinyl]oxan-3-olate |
|---|---|
| PubChem CID | 44817599 |
| Molecular Formula | C13H18ClN3O5SZn |
| Molecular Weight | 429.21 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | chlorozinc(1+);(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(phenylcarbamothioyl)hydrazinyl]oxan-3-olate |
| SMILES | Cl[Zn+].[O-][C@H]1C(NNC(=S)Nc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18N3O5S.ClH.Zn/c17-6-8-9(18)10(19)11(20)12(21-8)15-16-13(22)14-7-4-2-1-3-5-7;;/h1-5,8-12,15,17-19H,6H2,(H2,14,16,22);1H;/q-1;;+2/p-1/t8-,9-,10+,11-,12?;;/m1../s1 |
| InChIKey | YIODJHPISBLXPA-WEZOLOTASA-M |
| XLogP | -1.67 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.21 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|