C23H26N2O6S — CID 118712488
1-[3-[(E)-3-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-1-enyl]phenyl]-3-phenylthiourea (PubChem CID 118712488) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-[3-[(E)-3-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-1-enyl]phenyl]-3-phenylthiourea.
| Compound Name | 1-[3-[(E)-3-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-1-enyl]phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 118712488 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-[3-[(E)-3-oxo-4-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-1-enyl]phenyl]-3-phenylthiourea |
| SMILES | O=C(/C=C/c1cccc(NC(=S)Nc2ccccc2)c1)C[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H26N2O6S/c26-13-19-21(29)22(30)20(28)18(31-19)12-17(27)10-9-14-5-4-8-16(11-14)25-23(32)24-15-6-2-1-3-7-15/h1-11,18-22,26,28-30H,12-13H2,(H2,24,25,32)/b10-9+/t18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | UDFXKPXXQPEQHD-LOFDVNKYSA-N |
| XLogP | 1.31 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|