C17H22O5 — CID 147339359
(E)-1-phenyl-5-[(2R,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pent-1-en-3-one (PubChem CID 147339359) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (E)-1-phenyl-5-[(2R,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pent-1-en-3-one.
| Compound Name | (E)-1-phenyl-5-[(2R,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pent-1-en-3-one |
|---|---|
| PubChem CID | 147339359 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (E)-1-phenyl-5-[(2R,4S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]pent-1-en-3-one |
| SMILES | CC1O[C@H](CCC(=O)/C=C/c2ccccc2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H22O5/c1-11-15(19)17(21)16(20)14(22-11)10-9-13(18)8-7-12-5-3-2-4-6-12/h2-8,11,14-17,19-21H,9-10H2,1H3/b8-7+/t11?,14-,15-,16?,17+/m1/s1 |
| InChIKey | DDEDFSDYJUNSMT-FCLTUNKKSA-N |
| XLogP | 0.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|