C15H18O6 — CID 162871420
(2,3,5-trihydroxy-6-methyloxan-4-yl) 3-phenylprop-2-enoate (PubChem CID 162871420) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (2,3,5-trihydroxy-6-methyloxan-4-yl) 3-phenylprop-2-enoate.
| Compound Name | (2,3,5-trihydroxy-6-methyloxan-4-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162871420 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2,3,5-trihydroxy-6-methyloxan-4-yl) 3-phenylprop-2-enoate |
| SMILES | CC1OC(O)C(O)C(OC(=O)C=Cc2ccccc2)C1O |
| InChI | InChI=1S/C15H18O6/c1-9-12(17)14(13(18)15(19)20-9)21-11(16)8-7-10-5-3-2-4-6-10/h2-9,12-15,17-19H,1H3 |
| InChIKey | QLLTZMGQRQDGBL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|