C30H28O12 — CID 162976402
[(2S,3R,4R,5S,6S)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] 3-phenylprop-2-enoate (PubChem CID 162976402) has the molecular formula C30H28O12 and a molecular weight of 580.54 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] 3-phenylprop-2-enoate.
| Compound Name | [(2S,3R,4R,5S,6S)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162976402 |
| Molecular Formula | C30H28O12 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] 3-phenylprop-2-enoate |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2C(=O)c3c(O)cc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)[C@H](O)[C@H](OC(=O)C=Cc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C30H28O12/c1-14-24(36)28(41-22(35)10-7-15-5-3-2-4-6-15)26(38)30(39-14)42-29-25(37)23-20(34)12-17(31)13-21(23)40-27(29)16-8-9-18(32)19(33)11-16/h2-14,24,26-34,36,38H,1H3/t14-,24-,26+,27+,28+,29-,30-/m0/s1 |
| InChIKey | NYPYCPQTNYBOTK-QCDGRFMASA-N |
| XLogP | 2.30 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|