C42H40O11 — CID 10233925
(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2,3-dihydrochromen-4-one (PubChem CID 10233925) has the molecular formula C42H40O11 and a molecular weight of 720.77 g/mol. Its IUPAC name is (2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2,3-dihydrochromen-4-one.
| Compound Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 10233925 |
| Molecular Formula | C42H40O11 |
| Molecular Weight | 720.77 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| SMILES | C[C@@H]1OC(O[C@H]2C(=O)c3c(O)cc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H40O11/c1-25-37(48-22-26-11-5-2-6-12-26)40(49-23-27-13-7-3-8-14-27)41(50-24-28-15-9-4-10-16-28)42(51-25)53-39-36(47)35-33(46)20-30(43)21-34(35)52-38(39)29-17-18-31(44)32(45)19-29/h2-21,25,37-46H,22-24H2,1H3/t25-,37-,38+,39-,40+,41+,42?/m0/s1 |
| InChIKey | INHVWEHHCKYZGD-LJLDJHDSSA-N |
| XLogP | 6.71 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|