C24H28O7 — CID 91559965
[(3S,6R)-5-hydroxy-2-(hydroxymethyl)-4-methoxy-6-(2-phenylethoxy)oxan-3-yl] 3-phenylprop-2-enoate (PubChem CID 91559965) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(3S,6R)-5-hydroxy-2-(hydroxymethyl)-4-methoxy-6-(2-phenylethoxy)oxan-3-yl] 3-phenylprop-2-enoate.
| Compound Name | [(3S,6R)-5-hydroxy-2-(hydroxymethyl)-4-methoxy-6-(2-phenylethoxy)oxan-3-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 91559965 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(3S,6R)-5-hydroxy-2-(hydroxymethyl)-4-methoxy-6-(2-phenylethoxy)oxan-3-yl] 3-phenylprop-2-enoate |
| SMILES | COC1C(O)[C@H](OCCc2ccccc2)OC(CO)[C@@H]1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H28O7/c1-28-23-21(27)24(29-15-14-18-10-6-3-7-11-18)30-19(16-25)22(23)31-20(26)13-12-17-8-4-2-5-9-17/h2-13,19,21-25,27H,14-16H2,1H3/t19?,21?,22-,23?,24+/m0/s1 |
| InChIKey | MTMGFEMLGRYZRC-TYXDZGKNSA-N |
| XLogP | 1.96 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|