C23H34O7 — CID 44551497
[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl] (E)-3-phenylprop-2-enoate (PubChem CID 44551497) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 44551497 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](OC(=O)/C=C/c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C23H34O7/c1-2-3-4-5-6-10-15-28-23-21(27)22(20(26)18(16-24)29-23)30-19(25)14-13-17-11-8-7-9-12-17/h7-9,11-14,18,20-24,26-27H,2-6,10,15-16H2,1H3/b14-13+/t18-,20-,21-,22+,23-/m1/s1 |
| InChIKey | YFDYYYIETCUECR-DDNLXPDFSA-N |
| XLogP | 2.43 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|