C30H34O12 — CID 162823300
[(2R,3S,4R,5R,6R)-3,5-dihydroxy-2-methyl-6-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-phenylprop-2-enoyloxy)oxan-2-yl]methoxy]oxan-4-yl] 3-phenylprop-2-enoate (PubChem CID 162823300) has the molecular formula C30H34O12 and a molecular weight of 586.59 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,5-dihydroxy-2-methyl-6-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-phenylprop-2-enoyloxy)oxan-2-yl]methoxy]oxan-4-yl] 3-phenylprop-2-enoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,5-dihydroxy-2-methyl-6-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-phenylprop-2-enoyloxy)oxan-2-yl]methoxy]oxan-4-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162823300 |
| Molecular Formula | C30H34O12 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,5-dihydroxy-2-methyl-6-[[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-phenylprop-2-enoyloxy)oxan-2-yl]methoxy]oxan-4-yl] 3-phenylprop-2-enoate |
| SMILES | C[C@H]1O[C@@H](OC[C@@H]2O[C@@H](OC(=O)C=Cc3ccccc3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](OC(=O)C=Cc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C30H34O12/c1-17-23(33)28(41-21(31)14-12-18-8-4-2-5-9-18)27(37)29(39-17)38-16-20-24(34)25(35)26(36)30(40-20)42-22(32)15-13-19-10-6-3-7-11-19/h2-15,17,20,23-30,33-37H,16H2,1H3/t17-,20+,23+,24-,25+,26-,27-,28-,29-,30+/m1/s1 |
| InChIKey | CEYGYPUVRXNKQV-QSJPVUEZSA-N |
| XLogP | 0.16 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|