C14H20O4 — CID 90704833
2-methyl-6-(2-phenylethyl)oxane-3,4,5-triol (PubChem CID 90704833) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-methyl-6-(2-phenylethyl)oxane-3,4,5-triol.
| Compound Name | 2-methyl-6-(2-phenylethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90704833 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-methyl-6-(2-phenylethyl)oxane-3,4,5-triol |
| SMILES | CC1OC(CCc2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C14H20O4/c1-9-12(15)14(17)13(16)11(18-9)8-7-10-5-3-2-4-6-10/h2-6,9,11-17H,7-8H2,1H3 |
| InChIKey | VYXACCHAVPQKMS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |