C9H18O4 — CID 147741789
(3R,6R)-2-methyl-6-propyloxane-3,4,5-triol (PubChem CID 147741789) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3R,6R)-2-methyl-6-propyloxane-3,4,5-triol.
| Compound Name | (3R,6R)-2-methyl-6-propyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 147741789 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (3R,6R)-2-methyl-6-propyloxane-3,4,5-triol |
| SMILES | CCC[C@H]1OC(C)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C9H18O4/c1-3-4-6-8(11)9(12)7(10)5(2)13-6/h5-12H,3-4H2,1-2H3/t5?,6-,7+,8?,9?/m1/s1 |
| InChIKey | HALXFQVPQREDFB-MGPOHBFLSA-N |
| XLogP | -0.34 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |