C7H14O4S — CID 59680726
2-methyl-6-(sulfanylmethyl)oxane-3,4,5-triol (PubChem CID 59680726) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-methyl-6-(sulfanylmethyl)oxane-3,4,5-triol.
| Compound Name | 2-methyl-6-(sulfanylmethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59680726 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-methyl-6-(sulfanylmethyl)oxane-3,4,5-triol |
| SMILES | CC1OC(CS)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14O4S/c1-3-5(8)7(10)6(9)4(2-12)11-3/h3-10,12H,2H2,1H3 |
| InChIKey | QATBVZWOPFPRBX-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|