C14H22NO4+ — CID 7081010
2-phenylethyl-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]azanium (PubChem CID 7081010) has the molecular formula C14H22NO4+ and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-phenylethyl-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]azanium.
| Compound Name | 2-phenylethyl-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]azanium |
|---|---|
| PubChem CID | 7081010 |
| Molecular Formula | C14H22NO4+ |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-phenylethyl-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]azanium |
| SMILES | C[C@H]1O[C@@H]([NH2+]CCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21NO4/c1-9-11(16)12(17)13(18)14(19-9)15-8-7-10-5-3-2-4-6-10/h2-6,9,11-18H,7-8H2,1H3/p+1/t9-,11-,12+,13+,14-/m1/s1 |
| InChIKey | WEASWRDFMRNHED-QKGWFMCXSA-O |
| XLogP | -1.38 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |