C11H14O3 — CID 88976580
(2S,4R,5R)-2-methyl-5-phenyloxolane-3,4-diol (PubChem CID 88976580) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2S,4R,5R)-2-methyl-5-phenyloxolane-3,4-diol.
| Compound Name | (2S,4R,5R)-2-methyl-5-phenyloxolane-3,4-diol |
|---|---|
| PubChem CID | 88976580 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2S,4R,5R)-2-methyl-5-phenyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](c2ccccc2)[C@H](O)C1O |
| InChI | InChI=1S/C11H14O3/c1-7-9(12)10(13)11(14-7)8-5-3-2-4-6-8/h2-7,9-13H,1H3/t7-,9?,10+,11+/m0/s1 |
| InChIKey | MTBGDNZDDYTIFW-BSCWKYMNSA-N |
| XLogP | 0.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |