C14H18O5 — CID 46240977
1-phenyl-2-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone (PubChem CID 46240977) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-phenyl-2-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone.
| Compound Name | 1-phenyl-2-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone |
|---|---|
| PubChem CID | 46240977 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-phenyl-2-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethanone |
| SMILES | C[C@@H]1O[C@@H](CC(=O)c2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H18O5/c1-8-12(16)14(18)13(17)11(19-8)7-10(15)9-5-3-2-4-6-9/h2-6,8,11-14,16-18H,7H2,1H3/t8-,11-,12+,13+,14+/m0/s1 |
| InChIKey | LULZVMRONVIVHN-RDSIVUJASA-N |
| XLogP | 0.13 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |