About 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde
2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde (PubChem CID 88533979) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde |
| PubChem CID | 88533979 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde |
| SMILES | CC1OC(CC=O)C(O)C(O)C1O |
| InChI | InChI=1S/C8H14O5/c1-4-6(10)8(12)7(11)5(13-4)2-3-9/h3-8,10-12H,2H2,1H3 |
| InChIKey | LRUJDWKBYBJALM-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde?
The IUPAC name of 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde (CID 88533979) is 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde.
What is the SMILES notation for 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde?
The canonical SMILES for 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde is CC1OC(CC=O)C(O)C(O)C1O.
What is the InChIKey of 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde?
The InChIKey is LRUJDWKBYBJALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-4-6(10)8(12)7(11)5(13-4)2-3-9/h3-8,10-12H,2H2,1H3.
What are the key properties of 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde?
2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde has a molecular weight of 190.19 g/mol, XLogP of -1.55, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5-trihydroxy-6-methyloxan-2-yl)acetaldehyde is sourced from PubChem (CID 88533979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).