C9H16O4 — CID 123948642
4-(3,4-dihydroxy-5-methyloxolan-2-yl)butanal (PubChem CID 123948642) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 4-(3,4-dihydroxy-5-methyloxolan-2-yl)butanal.
| Compound Name | 4-(3,4-dihydroxy-5-methyloxolan-2-yl)butanal |
|---|---|
| PubChem CID | 123948642 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-(3,4-dihydroxy-5-methyloxolan-2-yl)butanal |
| SMILES | CC1OC(CCCC=O)C(O)C1O |
| InChI | InChI=1S/C9H16O4/c1-6-8(11)9(12)7(13-6)4-2-3-5-10/h5-9,11-12H,2-4H2,1H3 |
| InChIKey | BZCGVOGCHFDJGZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|